| Type: | Metabolite |
| PubChem: | 104842 |
| DrugBank: | None |
| IUPAC: | (19S)-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]heneicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| Standard InChI: | InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
| Standard InChIKey: | FJHBVJOVLFPMQE-QFIPXVFZSA-N |
| SMILES: | CCC1=C2CN3C(=CC4=C(COC(=O)C4(O)CC)C3=O)C2=NC2=CC=C(O)C=C12 |
| Chemical Structure | Parent compounds name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Irinotecan | Hydrolysis | Gut microbiota | Gut microbiota | 10.1080/03602532.2020.1718691 |