| Type: | Metabolite |
| PubChem: | 98914 |
| DrugBank: | None |
| IUPAC: | 5,8-dihydroxy-2-(4-methylpent-3-enyl)naphthalene-1,4-dione |
| Standard InChI: | InChI=1S/C16H16O4/c1-9(2)4-3-5-10-8-13(19)14-11(17)6-7-12(18)15(14)16(10)20/h4,6-8,17-18H,3,5H2,1-2H3 |
| Standard InChIKey: | VOMDIEGPEURZJO-UHFFFAOYSA-N |
| SMILES: | CC(C)=CCCC1=CC(=O)C2=C(O)C=CC(O)=C2C1=O |
| Chemical Structure | Parent compounds name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Shikonin | Reduction | Gut microbiota | Gut microbiota | 10.1016/S0040-4020(01)81108-X | |
| Shikonin | Reduction | Bacteroides | Unknown | Min, B. S., Meselhy, M. R., Hattori, M., Kim, H. M., & Kim, Y. H. (2000). Cytotoxicity of shikonin metabolites with biotransformation of human intestinal bacteria. Journal of microbiology and biotechnology, 10(4), 514-517. |