| Type: | Metabolite |
| PubChem: | 14340 |
| DrugBank: | None |
| IUPAC: | 3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| Standard InChI: | InChI=1S/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13) |
| Standard InChIKey: | BOLQJTPHPSDZHR-UHFFFAOYSA-N |
| SMILES: | COC1=CC(CCC(=O)O)=CC=C1O |
| Chemical Structure | Parent compounds name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Curcumin | Hydrolysis | Gut microbiota | Gut microbiota | 10.3109/09637486.2015.1095865 | |
| Ferulic acid | Reduction | Gut microbiota | Gut microbiota | 10.3945/ajcn.110.002188 | |
| Demethoxycurcumin | Hydrolysis | Gut microbiota | Gut microbiota | 10.3109/09637486.2015.1095865 |