|
Type:
|
Dietary supplement |
|
PubChem:
|
5281377
|
|
DrugBank:
|
None
|
|
IUPAC:
|
5-hydroxy-3-(4-hydroxyphenyl)-7-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-1-benzopyran-4-one |
|
Standard InChI:
|
InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
|
Standard InChIKey:
|
ZCOLJUOHXJRHDI-CMWLGVBASA-N |
|
SMILES:
|
O=C1C(C2=CC=C(O)C=C2)=COC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC(O)=C12 |
|
Metabolism-related information:
|
Increase adsorption in gut by hydrolysis into deglycosylation form
|
|
Reference:
|
10.3390/molecules21081034 |