|
Type:
|
Approved drug |
|
PubChem:
|
11333
|
|
DrugBank:
|
DB00581
|
|
IUPAC:
|
(2S,3R,4S,5R,6R)-2-[[(2R,3S,4S,5R)-4,5-dihydroxy-2,5-bis(hydroxymethyl)-3-oxolanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|
Standard InChI:
|
InChI=1S/C12H22O11/c13-1-4-6(16)7(17)8(18)11(21-4)22-9-5(2-14)23-12(20,3-15)10(9)19/h4-11,13-20H,1-3H2/t4-,5-,6+,7+,8-,9-,10+,11+,12-/m1/s1 |
|
Standard InChIKey:
|
JCQLYHFGKNRPGE-FCVZTGTOSA-N |
|
SMILES:
|
OCC1OC(OC2C(CO)OC(O)(CO)C2O)C(O)C(O)C1O |
|
Metabolism-related information:
|
Stimulating the growth of beneficial bacteria such as Bifidobacteria and Lactobacilli and increase activity
|
|
Reference:
|
10.1517/17425255.2016.1121234 |