| Type: | Other |
| PubChem: | 64981 |
| DrugBank: | DB16880 |
| IUPAC: | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2-oxolanone |
| Standard InChI: | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 |
| Standard InChIKey: | NQWVSMVXKMHKTF-JKSUJKDBSA-N |
| SMILES: | COC1=CC(CC2C(=O)OCC2CC2=CC=C(OC)C(OC)=C2)=CC=C1O |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| (3R,4R)-3,4-bis(3,4-dihydroxybenzyl)dihydrofuran-2(3H)-one | Dealkylation | Gut microbiota | Gut microbiota | 10.3390/molecules21081034 |