| Type: | Dietary supplement |
| PubChem: | 689043 |
| DrugBank: | None |
| IUPAC: | (E)-3-(3,4-dihydroxyphenyl)-2-propenoic acid |
| Standard InChI: | InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
| Standard InChIKey: | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| SMILES: | O=C(O)C=CC1=CC=C(O)C(O)=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 3-(3,4-Dihydroxyphenyl)propionic acid | Reduction | Gut microbiota | Gut microbiota | 10.1016/j.freeradbiomed.2003.09.022 | |
| caffeoyl-o-quinone | Oxidation | Lactobacillus | Unknown | 10.1039/D1FO04304H | |
| 3-(3,4-Dihydroxyphenyl)propionic acid | Reduction | Lactobacillus | Unknown | 10.1039/D1FO04304H |