| Type: | Approved drug |
| PubChem: | 4594 |
| DrugBank: | DB00338 |
| IUPAC: | 6-methoxy-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole |
| Standard InChI: | InChI=1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
| Standard InChIKey: | SUBDBMMJDZJVOS-UHFFFAOYSA-N |
| SMILES: | COC1=CC=C2N=C(S(=O)CC3=NC=C(C)C(OC)=C3C)[NH]C2=C1 |
| Metabolism-related information: | Decreased activity |
| Reference: | 10.1517/17425255.2016.1121234 |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Ufiprazole | Reduction | Gut microbiota | Gut microbiota | 10.1517/17425255.2016.1121234 |