| Type: | Approved drug |
| PubChem: | 4506 |
| DrugBank: | DB01595 |
| IUPAC: | 7-nitro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| Standard InChI: | InChI=1S/C15H11N3O3/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14/h1-8H,9H2,(H,17,19) |
| Standard InChIKey: | KJONHKAYOJNZEC-UHFFFAOYSA-N |
| SMILES: | O=C1CN=C(C2=CC=CC=C2)C2=CC([N+](=O)[O-])=CC=C2N1 |
| Metabolism-related information: | Inducing teratogenicity; Increase neurotoxicity |
| Reference: | 10.1517/17425255.2016.1121234; 10.1080/03602532.2020.1718691 |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 7-Aminonitrazepam | Reduction | Escherichia | coli | 10.1016/j.bcp.2009.03.019 |