|
Type:
|
Dietary supplement |
|
PubChem:
|
100528
|
|
DrugBank:
|
None
|
|
IUPAC:
|
(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[[3-methoxy-4-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]phenyl]methyl]-2-oxolanone |
|
Standard InChI:
|
InChI=1S/C27H34O11/c1-33-18-6-4-14(10-20(18)34-2)8-16-13-36-26(32)17(16)9-15-5-7-19(21(11-15)35-3)37-27-25(31)24(30)23(29)22(12-28)38-27/h4-7,10-11,16-17,22-25,27-31H,8-9,12-13H2,1-3H3/t16-,17+,22+,23+,24-,25+,27+/m0/s1 |
|
Standard InChIKey:
|
XOJVHLIYNSOZOO-SWOBOCGESA-N |
|
SMILES:
|
COC1=CC=C(CC2COC(=O)C2CC2=CC=C(OC3OC(CO)C(O)C(O)C3O)C(OC)=C2)C=C1OC |
|
Metabolism-related information:
|
Increase adsorption in gut by hydrolysis into deglycosylation form
|
|
Reference:
|
10.3390/molecules21081034 |