| Type: | Other |
| PubChem: | 119358 |
| DrugBank: | None |
| IUPAC: | 6-nitrosobenzo[a]pyrene |
| Standard InChI: | InChI=1S/C20H11NO/c22-21-20-16-7-2-1-6-14(16)15-10-8-12-4-3-5-13-9-11-17(20)19(15)18(12)13/h1-11H |
| Standard InChIKey: | ICRDTHCKNWXAFG-UHFFFAOYSA-N |
| SMILES: | O=NC1=C2C=CC=CC2=C2C=CC3=CC=CC4=CC=C1C2=C43 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 6-Aminobenzo(a)pyrene | Reduction | Sahnonella | typhimurium | 10.1016/0165-7992(88)90028-0 |