| Type: | Other |
| PubChem: | 119033 |
| DrugBank: | None |
| IUPAC: | (2R)-2-phenyl-2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]acetonitrile |
| Standard InChI: | InChI=1S/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9-,10+,11+,12-,13+,14+/m0/s1 |
| Standard InChIKey: | ZKSZEJFBGODIJW-GMDXDWKASA-N |
| SMILES: | N#CC(OC1OC(CO)C(O)C(O)C1O)C1=CC=CC=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Mandelonitrile | Hydrolysis | Gut microbiota | Gut microbiota | 10.3109/09637481003796314 |