| Type: | Dietary supplement |
| PubChem: | 441773 |
| DrugBank: | None |
| IUPAC: | 2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium-3,5,7-triol |
| Standard InChI: | InChI=1S/C16H12O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-7H,1H3,(H3-,17,18,19,20)/p+1 |
| Standard InChIKey: | XFDQJKDGGOEYPI-UHFFFAOYSA-O |
| SMILES: | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC=C1O |
| Metabolism-related information: | Increase activity and absorption |
| Reference: | 10.1155/2015/905215 |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Vanillic acid | Ring fission | Lactobacillus | Unknown | 10.1155/2015/905215 | |
| Vanillic acid | Ring fission | Bifidobacterium | Unknown | 10.1155/2015/905215 |