| Type: | Approved drug |
| PubChem: | 6256 |
| DrugBank: | DB00432 |
| IUPAC: | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-oxolanyl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| Standard InChI: | InChI=1S/C10H11F3N2O5/c11-10(12,13)4-2-15(9(19)14-8(4)18)7-1-5(17)6(3-16)20-7/h2,5-7,16-17H,1,3H2,(H,14,18,19)/t5-,6+,7+/m0/s1 |
| Standard InChIKey: | VSQQQLOSPVPRAZ-RRKCRQDMSA-N |
| SMILES: | O=C1[NH]C(=O)N(C2CC(O)C(CO)O2)C=C1C(F)(F)F |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 5-(Trifluoromethyl)uracil | Hydrolysis | Gut microbiota | Gut microbiota | 10.1016/j.cell.2020.05.001 |