| Type: | Approved drug |
| PubChem: | 5315 |
| DrugBank: | DB13580 |
| IUPAC: | 4-oxo-4-[4-(2-thiazolylsulfamoyl)anilino]butanoic acid |
| Standard InChI: | InChI=1S/C13H13N3O5S2/c17-11(5-6-12(18)19)15-9-1-3-10(4-2-9)23(20,21)16-13-14-7-8-22-13/h1-4,7-8H,5-6H2,(H,14,16)(H,15,17)(H,18,19) |
| Standard InChIKey: | SKVLYVHULOWXTD-UHFFFAOYSA-N |
| SMILES: | O=C(O)CCC(=O)NC1=CC=C(S(=O)(=O)NC2=NC=CS2)C=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Sulfathiazole | Cleavage | Gut microbiota | Gut microbiota | 10.1080/03602532.2018.1497647 |