| Type: | Dietary supplement |
| PubChem: | 9064 |
| DrugBank: | None |
| IUPAC: | (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol |
| Standard InChI: | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
| Standard InChIKey: | PFTAWBLQPZVEMU-DZGCQCFKSA-N |
| SMILES: | OC1=CC(O)=C2CC(O)C(C3=CC=C(O)C(O)=C3)OC2=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 5-(3,4-Dihydroxyphenyl)-valerolactone | Unknown | Clostridium | coccoides | 10.1155/2015/905215 | |
| 3-(3-Hydroxyphenyl)propanoic acid | Unknown | Clostridium | coccoides | 10.1155/2015/905215 | |
| 1-(3', 4'-dihydroxyphenyl)-3-(2'',4'',6''-trihydroxyphenyl)propan-2-ol | Ring fission | Eggerthella | lenta rK3 | 10.1016/j.trsl.2016.08.002 |