| Type: | Approved drug |
| PubChem: | 77997 |
| DrugBank: | DB00953 |
| IUPAC: | benzoic acid;N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
| Standard InChI: | InChI=1S/C15H19N5.C7H6O2/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20;8-7(9)6-4-2-1-3-5-6/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3;1-5H,(H,8,9) |
| Standard InChIKey: | JPRXYLQNJJVCMZ-UHFFFAOYSA-N |
| SMILES: | CN(C)CCC1=C[NH]C2=CC=C(CN3C=NC=N3)C=C12.O=C(O)C1=CC=CC=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| None | Unknown | Unknown | Gut microbiota | Gut microbiota | 10.1038/s41586-019-1291-3 |