| Type: | Other |
| PubChem: | 3036 |
| DrugBank: | None |
| IUPAC: | 1-chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]benzene |
| Standard InChI: | InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H |
| Standard InChIKey: | YVGGHNCTFXOJCH-UHFFFAOYSA-N |
| SMILES: | ClC1=CC=C(C(C2=CC=C(Cl)C=C2)C(Cl)(Cl)Cl)C=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| Dichlorodiphenyldichloroethane | Dechlorination | Gut microbiota | Gut microbiota | 10.1038/npjbiofilms.2016.3 |