| Type: | Other |
| PubChem: | 637542 |
| DrugBank: | DB04066 |
| IUPAC: | (E)-3-(4-hydroxyphenyl)-2-propenoic acid |
| Standard InChI: | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
| Standard InChIKey: | NGSWKAQJJWESNS-ZZXKWVIFSA-N |
| SMILES: | O=C(O)C=CC1=CC=C(O)C=C1 |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 3-(3-Hydroxyphenyl)propanoic acid | Reduction | Lactobacillus | Unknown | 10.1039/D1FO04304H |