| Type: | Other |
| PubChem: | 20170 |
| DrugBank: | None |
| IUPAC: | disodium;2-[(2-hydroxy-1-naphthalenyl)azo]-5-(4-sulfonatophenyl)azobenzenesulfonate |
| Standard InChI: | InChI=1S/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2 |
| Standard InChIKey: | VVAVKBBTPWYADW-UHFFFAOYSA-L |
| SMILES: | O=S(=O)([O-])C1=CC=C(N=NC2=CC=C(N=NC3=C(O)C=CC4=CC=CC=C34)C(S(=O)(=O)[O-])=C2)C=C1.[Na+].[Na+] |
| Metabolism-related information: | No data |
| Reference: | No data |
| Chemical Structure | Metablite's name | Reaction name | Genus | Species | Reference |
|---|---|---|---|---|---|
| 1-Amino-2-naphthol | Reduction | Clostridium | Unknown | 10.1016/bs.pmbts.2020.04.002 | |
| Sulfanilic acid | Reduction | Clostridium | Unknown | 10.1016/bs.pmbts.2020.04.002 |